C18H21FO2 — CID 10924200
(8S,9S,10S,13S,14S)-10-fluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 10924200) has the molecular formula C18H21FO2 and a molecular weight of 288.36 g/mol. Its IUPAC name is (8S,9S,10S,13S,14S)-10-fluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8S,9S,10S,13S,14S)-10-fluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 10924200 |
| Molecular Formula | C18H21FO2 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (8S,9S,10S,13S,14S)-10-fluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)C=C[C@@]43F)[C@@H]1CCC2=O |
| InChI | InChI=1S/C18H21FO2/c1-17-8-7-15-13(14(17)4-5-16(17)21)3-2-11-10-12(20)6-9-18(11,15)19/h6,9-10,13-15H,2-5,7-8H2,1H3/t13-,14-,15-,17-,18+/m0/s1 |
| InChIKey | OMTJIOYRKGFHRZ-FTAMUGHTSA-N |
| XLogP | 3.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |