C16H14N6 — CID 10924242
5,12-diazidotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene (PubChem CID 10924242) has the molecular formula C16H14N6 and a molecular weight of 290.33 g/mol. Its IUPAC name is 5,12-diazidotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene.
| Compound Name | 5,12-diazidotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene |
|---|---|
| PubChem CID | 10924242 |
| Molecular Formula | C16H14N6 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 5,12-diazidotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene |
| SMILES | [N-]=[N+]=Nc1cc2ccc1CCc1ccc(cc1N=[N+]=[N-])CC2 |
| InChI | InChI=1S/C16H14N6/c17-21-19-15-9-11-1-2-12-4-6-14(16(10-12)20-22-18)8-7-13(15)5-3-11/h3-6,9-10H,1-2,7-8H2 |
| InChIKey | VJYLLGUTHZEYFE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|