C22H19N3O2 — CID 109242503
N-(3-acetylphenyl)-5-(2,3-dihydroindol-1-yl)pyridine-3-carboxamide (PubChem CID 109242503) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-(3-acetylphenyl)-5-(2,3-dihydroindol-1-yl)pyridine-3-carboxamide.
| Compound Name | N-(3-acetylphenyl)-5-(2,3-dihydroindol-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109242503 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-(3-acetylphenyl)-5-(2,3-dihydroindol-1-yl)pyridine-3-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2cncc(N3CCc4ccccc43)c2)c1 |
| InChI | InChI=1S/C22H19N3O2/c1-15(26)17-6-4-7-19(11-17)24-22(27)18-12-20(14-23-13-18)25-10-9-16-5-2-3-8-21(16)25/h2-8,11-14H,9-10H2,1H3,(H,24,27) |
| InChIKey | JLQQMGYJJIUGGN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |