C22H23N3O — CID 109242782
N-(2,5-dimethylphenyl)-5-(2-ethylanilino)pyridine-3-carboxamide (PubChem CID 109242782) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-5-(2-ethylanilino)pyridine-3-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-5-(2-ethylanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109242782 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-(2,5-dimethylphenyl)-5-(2-ethylanilino)pyridine-3-carboxamide |
| SMILES | CCc1ccccc1Nc1cncc(C(=O)Nc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C22H23N3O/c1-4-17-7-5-6-8-20(17)24-19-12-18(13-23-14-19)22(26)25-21-11-15(2)9-10-16(21)3/h5-14,24H,4H2,1-3H3,(H,25,26) |
| InChIKey | AEEQTPVVCOFLJS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |