C23H24N4O2 — CID 109243693
5-(4-acetamidoanilino)-N-(2-ethyl-6-methylphenyl)pyridine-3-carboxamide (PubChem CID 109243693) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 5-(4-acetamidoanilino)-N-(2-ethyl-6-methylphenyl)pyridine-3-carboxamide.
| Compound Name | 5-(4-acetamidoanilino)-N-(2-ethyl-6-methylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109243693 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 5-(4-acetamidoanilino)-N-(2-ethyl-6-methylphenyl)pyridine-3-carboxamide |
| SMILES | CCc1cccc(C)c1NC(=O)c1cncc(Nc2ccc(NC(C)=O)cc2)c1 |
| InChI | InChI=1S/C23H24N4O2/c1-4-17-7-5-6-15(2)22(17)27-23(29)18-12-21(14-24-13-18)26-20-10-8-19(9-11-20)25-16(3)28/h5-14,26H,4H2,1-3H3,(H,25,28)(H,27,29) |
| InChIKey | UFBRUAQAGALPAQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |