C20H18ClN3O3 — CID 109244383
N-(2-chlorophenyl)-5-(2,5-dimethoxyanilino)pyridine-3-carboxamide (PubChem CID 109244383) has the molecular formula C20H18ClN3O3 and a molecular weight of 383.84 g/mol. Its IUPAC name is N-(2-chlorophenyl)-5-(2,5-dimethoxyanilino)pyridine-3-carboxamide.
| Compound Name | N-(2-chlorophenyl)-5-(2,5-dimethoxyanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109244383 |
| Molecular Formula | C20H18ClN3O3 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N-(2-chlorophenyl)-5-(2,5-dimethoxyanilino)pyridine-3-carboxamide |
| SMILES | COc1ccc(OC)c(Nc2cncc(C(=O)Nc3ccccc3Cl)c2)c1 |
| InChI | InChI=1S/C20H18ClN3O3/c1-26-15-7-8-19(27-2)18(10-15)23-14-9-13(11-22-12-14)20(25)24-17-6-4-3-5-16(17)21/h3-12,23H,1-2H3,(H,24,25) |
| InChIKey | OYUDHSQIQQOIHL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |