C20H17F2N3O2 — CID 109245490
N-(2,4-difluorophenyl)-5-(4-ethoxyanilino)pyridine-3-carboxamide (PubChem CID 109245490) has the molecular formula C20H17F2N3O2 and a molecular weight of 369.37 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-5-(4-ethoxyanilino)pyridine-3-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-5-(4-ethoxyanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109245490 |
| Molecular Formula | C20H17F2N3O2 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-(2,4-difluorophenyl)-5-(4-ethoxyanilino)pyridine-3-carboxamide |
| SMILES | CCOc1ccc(Nc2cncc(C(=O)Nc3ccc(F)cc3F)c2)cc1 |
| InChI | InChI=1S/C20H17F2N3O2/c1-2-27-17-6-4-15(5-7-17)24-16-9-13(11-23-12-16)20(26)25-19-8-3-14(21)10-18(19)22/h3-12,24H,2H2,1H3,(H,25,26) |
| InChIKey | POUUSVNGMDAQGP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |