C21H18N4O2 — CID 109245547
N-(2-cyanophenyl)-5-(2-methoxy-5-methylanilino)pyridine-3-carboxamide (PubChem CID 109245547) has the molecular formula C21H18N4O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is N-(2-cyanophenyl)-5-(2-methoxy-5-methylanilino)pyridine-3-carboxamide.
| Compound Name | N-(2-cyanophenyl)-5-(2-methoxy-5-methylanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109245547 |
| Molecular Formula | C21H18N4O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-(2-cyanophenyl)-5-(2-methoxy-5-methylanilino)pyridine-3-carboxamide |
| SMILES | COc1ccc(C)cc1Nc1cncc(C(=O)Nc2ccccc2C#N)c1 |
| InChI | InChI=1S/C21H18N4O2/c1-14-7-8-20(27-2)19(9-14)24-17-10-16(12-23-13-17)21(26)25-18-6-4-3-5-15(18)11-22/h3-10,12-13,24H,1-2H3,(H,25,26) |
| InChIKey | QQJOHVMPOMSNOH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |