C20H15ClFN3O3 — CID 109245987
methyl 4-chloro-3-[[5-[(3-fluorophenyl)carbamoyl]-3-pyridinyl]amino]benzoate (PubChem CID 109245987) has the molecular formula C20H15ClFN3O3 and a molecular weight of 399.81 g/mol. Its IUPAC name is methyl 4-chloro-3-[[5-[(3-fluorophenyl)carbamoyl]-3-pyridinyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[5-[(3-fluorophenyl)carbamoyl]-3-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 109245987 |
| Molecular Formula | C20H15ClFN3O3 |
| Molecular Weight | 399.81 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | methyl 4-chloro-3-[[5-[(3-fluorophenyl)carbamoyl]-3-pyridinyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(Nc2cncc(C(=O)Nc3cccc(F)c3)c2)c1 |
| InChI | InChI=1S/C20H15ClFN3O3/c1-28-20(27)12-5-6-17(21)18(8-12)24-16-7-13(10-23-11-16)19(26)25-15-4-2-3-14(22)9-15/h2-11,24H,1H3,(H,25,26) |
| InChIKey | NDALYPFUTDKTRR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.81 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |