C22H15N5O — CID 109246222
N-(3-cyanophenyl)-5-(quinolin-8-ylamino)pyridine-3-carboxamide (PubChem CID 109246222) has the molecular formula C22H15N5O and a molecular weight of 365.40 g/mol. Its IUPAC name is N-(3-cyanophenyl)-5-(quinolin-8-ylamino)pyridine-3-carboxamide.
| Compound Name | N-(3-cyanophenyl)-5-(quinolin-8-ylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109246222 |
| Molecular Formula | C22H15N5O |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-(3-cyanophenyl)-5-(quinolin-8-ylamino)pyridine-3-carboxamide |
| SMILES | N#Cc1cccc(NC(=O)c2cncc(Nc3cccc4cccnc34)c2)c1 |
| InChI | InChI=1S/C22H15N5O/c23-12-15-4-1-7-18(10-15)27-22(28)17-11-19(14-24-13-17)26-20-8-2-5-16-6-3-9-25-21(16)20/h1-11,13-14,26H,(H,27,28) |
| InChIKey | CRVSDIMNDXVXNE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |