C14H14Cl2N4O — CID 109247242
N-(2,5-dichlorophenyl)-2-(propan-2-ylamino)pyrimidine-5-carboxamide (PubChem CID 109247242) has the molecular formula C14H14Cl2N4O and a molecular weight of 325.20 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-(propan-2-ylamino)pyrimidine-5-carboxamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-(propan-2-ylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109247242 |
| Molecular Formula | C14H14Cl2N4O |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-(propan-2-ylamino)pyrimidine-5-carboxamide |
| SMILES | CC(C)Nc1ncc(C(=O)Nc2cc(Cl)ccc2Cl)cn1 |
| InChI | InChI=1S/C14H14Cl2N4O/c1-8(2)19-14-17-6-9(7-18-14)13(21)20-12-5-10(15)3-4-11(12)16/h3-8H,1-2H3,(H,20,21)(H,17,18,19) |
| InChIKey | LTZNZNZJZDXEON-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |