C16H17ClN4O — CID 109247539
N-[2-(3-chlorophenyl)ethyl]-2-(cyclopropylamino)pyrimidine-5-carboxamide (PubChem CID 109247539) has the molecular formula C16H17ClN4O and a molecular weight of 316.79 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-2-(cyclopropylamino)pyrimidine-5-carboxamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-2-(cyclopropylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109247539 |
| Molecular Formula | C16H17ClN4O |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-2-(cyclopropylamino)pyrimidine-5-carboxamide |
| SMILES | O=C(NCCc1cccc(Cl)c1)c1cnc(NC2CC2)nc1 |
| InChI | InChI=1S/C16H17ClN4O/c17-13-3-1-2-11(8-13)6-7-18-15(22)12-9-19-16(20-10-12)21-14-4-5-14/h1-3,8-10,14H,4-7H2,(H,18,22)(H,19,20,21) |
| InChIKey | XICMENGTACSVKN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |