C18H21F2NO — CID 10924755
(2S,3R)-2-amino-4,4-difluoro-1,6-diphenylhexan-3-ol (PubChem CID 10924755) has the molecular formula C18H21F2NO and a molecular weight of 305.37 g/mol. Its IUPAC name is (2S,3R)-2-amino-4,4-difluoro-1,6-diphenylhexan-3-ol.
| Compound Name | (2S,3R)-2-amino-4,4-difluoro-1,6-diphenylhexan-3-ol |
|---|---|
| PubChem CID | 10924755 |
| Molecular Formula | C18H21F2NO |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (2S,3R)-2-amino-4,4-difluoro-1,6-diphenylhexan-3-ol |
| SMILES | N[C@@H](Cc1ccccc1)[C@@H](O)C(F)(F)CCc1ccccc1 |
| InChI | InChI=1S/C18H21F2NO/c19-18(20,12-11-14-7-3-1-4-8-14)17(22)16(21)13-15-9-5-2-6-10-15/h1-10,16-17,22H,11-13,21H2/t16-,17+/m0/s1 |
| InChIKey | WEDJJIRMFCQVHF-DLBZAZTESA-N |
| XLogP | 3.19 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |