C16H18O4S — CID 10924793
(3E,5E)-3-ethoxycarbonyl-5-methyl-6-phenylsulfanylhexa-3,5-dienoic acid (PubChem CID 10924793) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is (3E,5E)-3-ethoxycarbonyl-5-methyl-6-phenylsulfanylhexa-3,5-dienoic acid.
| Compound Name | (3E,5E)-3-ethoxycarbonyl-5-methyl-6-phenylsulfanylhexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 10924793 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (3E,5E)-3-ethoxycarbonyl-5-methyl-6-phenylsulfanylhexa-3,5-dienoic acid |
| SMILES | CCOC(=O)/C(=C/C(C)=C/Sc1ccccc1)CC(=O)O |
| InChI | InChI=1S/C16H18O4S/c1-3-20-16(19)13(10-15(17)18)9-12(2)11-21-14-7-5-4-6-8-14/h4-9,11H,3,10H2,1-2H3,(H,17,18)/b12-11+,13-9+ |
| InChIKey | FXKGPLDHFSGMBL-HYKWIDACSA-N |
| XLogP | 3.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|