C17H20N4O2 — CID 109249149
N-(3-acetylphenyl)-2-(butan-2-ylamino)pyrimidine-5-carboxamide (PubChem CID 109249149) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-(butan-2-ylamino)pyrimidine-5-carboxamide.
| Compound Name | N-(3-acetylphenyl)-2-(butan-2-ylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109249149 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-(3-acetylphenyl)-2-(butan-2-ylamino)pyrimidine-5-carboxamide |
| SMILES | CCC(C)Nc1ncc(C(=O)Nc2cccc(C(C)=O)c2)cn1 |
| InChI | InChI=1S/C17H20N4O2/c1-4-11(2)20-17-18-9-14(10-19-17)16(23)21-15-7-5-6-13(8-15)12(3)22/h5-11H,4H2,1-3H3,(H,21,23)(H,18,19,20) |
| InChIKey | LGCYLVCTQWJZPL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |