C15H15FN4O — CID 109249311
[2-(4-fluoroanilino)pyrimidin-5-yl]-pyrrolidin-1-ylmethanone (PubChem CID 109249311) has the molecular formula C15H15FN4O and a molecular weight of 286.31 g/mol. Its IUPAC name is [2-(4-fluoroanilino)pyrimidin-5-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [2-(4-fluoroanilino)pyrimidin-5-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 109249311 |
| Molecular Formula | C15H15FN4O |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | [2-(4-fluoroanilino)pyrimidin-5-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cnc(Nc2ccc(F)cc2)nc1)N1CCCC1 |
| InChI | InChI=1S/C15H15FN4O/c16-12-3-5-13(6-4-12)19-15-17-9-11(10-18-15)14(21)20-7-1-2-8-20/h3-6,9-10H,1-2,7-8H2,(H,17,18,19) |
| InChIKey | ZZAFEPASMLXLAI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |