C19H24N4O — CID 109249624
N-cyclopentyl-2-(2,4,6-trimethylanilino)pyrimidine-5-carboxamide (PubChem CID 109249624) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is N-cyclopentyl-2-(2,4,6-trimethylanilino)pyrimidine-5-carboxamide.
| Compound Name | N-cyclopentyl-2-(2,4,6-trimethylanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109249624 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | N-cyclopentyl-2-(2,4,6-trimethylanilino)pyrimidine-5-carboxamide |
| SMILES | Cc1cc(C)c(Nc2ncc(C(=O)NC3CCCC3)cn2)c(C)c1 |
| InChI | InChI=1S/C19H24N4O/c1-12-8-13(2)17(14(3)9-12)23-19-20-10-15(11-21-19)18(24)22-16-6-4-5-7-16/h8-11,16H,4-7H2,1-3H3,(H,22,24)(H,20,21,23) |
| InChIKey | DXKVPFZESPCHIA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |