C18H40O2Si — CID 10925150
tert-butyl-dimethoxy-(2,4,4,6,6-pentamethylheptyl)silane (PubChem CID 10925150) has the molecular formula C18H40O2Si and a molecular weight of 316.60 g/mol. Its IUPAC name is tert-butyl-dimethoxy-(2,4,4,6,6-pentamethylheptyl)silane.
| Compound Name | tert-butyl-dimethoxy-(2,4,4,6,6-pentamethylheptyl)silane |
|---|---|
| PubChem CID | 10925150 |
| Molecular Formula | C18H40O2Si |
| Molecular Weight | 316.60 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | tert-butyl-dimethoxy-(2,4,4,6,6-pentamethylheptyl)silane |
| SMILES | CO[Si](CC(C)CC(C)(C)CC(C)(C)C)(OC)C(C)(C)C |
| InChI | InChI=1S/C18H40O2Si/c1-15(12-18(8,9)14-16(2,3)4)13-21(19-10,20-11)17(5,6)7/h15H,12-14H2,1-11H3 |
| InChIKey | CXCOWDSITGLSJF-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.60 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|