C21H35NO — CID 10925178
(2R,3R,6S)-2-methyl-6-(9-phenylnonyl)piperidin-3-ol (PubChem CID 10925178) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is (2R,3R,6S)-2-methyl-6-(9-phenylnonyl)piperidin-3-ol.
| Compound Name | (2R,3R,6S)-2-methyl-6-(9-phenylnonyl)piperidin-3-ol |
|---|---|
| PubChem CID | 10925178 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | (2R,3R,6S)-2-methyl-6-(9-phenylnonyl)piperidin-3-ol |
| SMILES | C[C@H]1N[C@@H](CCCCCCCCCc2ccccc2)CC[C@H]1O |
| InChI | InChI=1S/C21H35NO/c1-18-21(23)17-16-20(22-18)15-11-6-4-2-3-5-8-12-19-13-9-7-10-14-19/h7,9-10,13-14,18,20-23H,2-6,8,11-12,15-17H2,1H3/t18-,20+,21-/m1/s1 |
| InChIKey | XFSGJROMOFEUFI-HLAWJBBLSA-N |
| XLogP | 4.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|