C18H24O5 — CID 10925247
[2-[(E)-2-[(3aR,4R,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]ethenyl]-6-methoxyphenyl]methanol (PubChem CID 10925247) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is [2-[(E)-2-[(3aR,4R,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]ethenyl]-6-methoxyphenyl]methanol.
| Compound Name | [2-[(E)-2-[(3aR,4R,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]ethenyl]-6-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 10925247 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | [2-[(E)-2-[(3aR,4R,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]ethenyl]-6-methoxyphenyl]methanol |
| SMILES | COc1cccc(/C=C/[C@H]2O[C@@H](C)[C@@H]3OC(C)(C)O[C@@H]32)c1CO |
| InChI | InChI=1S/C18H24O5/c1-11-16-17(23-18(2,3)22-16)15(21-11)9-8-12-6-5-7-14(20-4)13(12)10-19/h5-9,11,15-17,19H,10H2,1-4H3/b9-8+/t11-,15+,16-,17+/m0/s1 |
| InChIKey | VWBHJSCNRRFBFS-SCZBPKQMSA-N |
| XLogP | 2.51 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |