About pyridine;triphenylborane
pyridine;triphenylborane (PubChem CID 10925275) has the molecular formula C23H20BN
and a molecular weight of 321.23 g/mol. Its IUPAC name is pyridine;triphenylborane.
Molecular Properties
| Compound Name | pyridine;triphenylborane |
| PubChem CID | 10925275 |
| Molecular Formula | C23H20BN |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | pyridine;triphenylborane |
| SMILES | c1ccc(B(c2ccccc2)c2ccccc2)cc1.c1ccncc1 |
| InChI | InChI=1S/C18H15B.C5H5N/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-4-6-5-3-1/h1-15H;1-5H |
| InChIKey | WJSXSXUHWBSPEP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze pyridine;triphenylborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine;triphenylborane?
The IUPAC name of pyridine;triphenylborane (CID 10925275) is pyridine;triphenylborane.
What is the SMILES notation for pyridine;triphenylborane?
The canonical SMILES for pyridine;triphenylborane is c1ccc(B(c2ccccc2)c2ccccc2)cc1.c1ccncc1.
What is the InChIKey of pyridine;triphenylborane?
The InChIKey is WJSXSXUHWBSPEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15B.C5H5N/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-4-6-5-3-1/h1-15H;1-5H.
What are the key properties of pyridine;triphenylborane?
pyridine;triphenylborane has a molecular weight of 321.23 g/mol, XLogP of 3.28, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine;triphenylborane is sourced from PubChem (CID 10925275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).