C15H16FN3O4 — CID 10925279
ethyl 1-[4-fluoro-2-(methylcarbamoyl)phenyl]-5-(hydroxymethyl)imidazole-4-carboxylate (PubChem CID 10925279) has the molecular formula C15H16FN3O4 and a molecular weight of 321.31 g/mol. Its IUPAC name is ethyl 1-[4-fluoro-2-(methylcarbamoyl)phenyl]-5-(hydroxymethyl)imidazole-4-carboxylate.
| Compound Name | ethyl 1-[4-fluoro-2-(methylcarbamoyl)phenyl]-5-(hydroxymethyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 10925279 |
| Molecular Formula | C15H16FN3O4 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | ethyl 1-[4-fluoro-2-(methylcarbamoyl)phenyl]-5-(hydroxymethyl)imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncn(-c2ccc(F)cc2C(=O)NC)c1CO |
| InChI | InChI=1S/C15H16FN3O4/c1-3-23-15(22)13-12(7-20)19(8-18-13)11-5-4-9(16)6-10(11)14(21)17-2/h4-6,8,20H,3,7H2,1-2H3,(H,17,21) |
| InChIKey | OSZFUBFDXNRAHT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |