C15H18BrN5O — CID 109253002
N-(3-bromophenyl)-2-[2-(dimethylamino)ethylamino]pyrimidine-5-carboxamide (PubChem CID 109253002) has the molecular formula C15H18BrN5O and a molecular weight of 364.25 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-[2-(dimethylamino)ethylamino]pyrimidine-5-carboxamide.
| Compound Name | N-(3-bromophenyl)-2-[2-(dimethylamino)ethylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109253002 |
| Molecular Formula | C15H18BrN5O |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | N-(3-bromophenyl)-2-[2-(dimethylamino)ethylamino]pyrimidine-5-carboxamide |
| SMILES | CN(C)CCNc1ncc(C(=O)Nc2cccc(Br)c2)cn1 |
| InChI | InChI=1S/C15H18BrN5O/c1-21(2)7-6-17-15-18-9-11(10-19-15)14(22)20-13-5-3-4-12(16)8-13/h3-5,8-10H,6-7H2,1-2H3,(H,20,22)(H,17,18,19) |
| InChIKey | BDAUONLTGHORFN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |