C20H24O2Si — CID 10925395
2-[(3R,5S)-2,2-diphenyl-5-propan-2-yloxasilolan-3-yl]acetaldehyde (PubChem CID 10925395) has the molecular formula C20H24O2Si and a molecular weight of 324.50 g/mol. Its IUPAC name is 2-[(3R,5S)-2,2-diphenyl-5-propan-2-yloxasilolan-3-yl]acetaldehyde.
| Compound Name | 2-[(3R,5S)-2,2-diphenyl-5-propan-2-yloxasilolan-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 10925395 |
| Molecular Formula | C20H24O2Si |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-[(3R,5S)-2,2-diphenyl-5-propan-2-yloxasilolan-3-yl]acetaldehyde |
| SMILES | CC(C)[C@@H]1C[C@H](CC=O)[Si](c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C20H24O2Si/c1-16(2)20-15-19(13-14-21)23(22-20,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,14,16,19-20H,13,15H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | GVEOARJOMITYBL-PMACEKPBSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|