C19H25N5O2 — CID 109254161
2-(4-ethylpiperazin-1-yl)-N-[(2-methoxyphenyl)methyl]pyrimidine-5-carboxamide (PubChem CID 109254161) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-N-[(2-methoxyphenyl)methyl]pyrimidine-5-carboxamide.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-N-[(2-methoxyphenyl)methyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109254161 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-N-[(2-methoxyphenyl)methyl]pyrimidine-5-carboxamide |
| SMILES | CCN1CCN(c2ncc(C(=O)NCc3ccccc3OC)cn2)CC1 |
| InChI | InChI=1S/C19H25N5O2/c1-3-23-8-10-24(11-9-23)19-21-13-16(14-22-19)18(25)20-12-15-6-4-5-7-17(15)26-2/h4-7,13-14H,3,8-12H2,1-2H3,(H,20,25) |
| InChIKey | HCLYMQLYSUXPDN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |