About 4-[(2R,3S)-1,4-diethyl-3-(4-hydroxyphenyl)piperazin-2-yl]phenol
4-[(2R,3S)-1,4-diethyl-3-(4-hydroxyphenyl)piperazin-2-yl]phenol (PubChem CID 10925438) has the molecular formula C20H26N2O2
and a molecular weight of 326.44 g/mol. Its IUPAC name is 4-[(2R,3S)-1,4-diethyl-3-(4-hydroxyphenyl)piperazin-2-yl]phenol.
Molecular Properties
| Compound Name | 4-[(2R,3S)-1,4-diethyl-3-(4-hydroxyphenyl)piperazin-2-yl]phenol |
| PubChem CID | 10925438 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 4-[(2R,3S)-1,4-diethyl-3-(4-hydroxyphenyl)piperazin-2-yl]phenol |
| SMILES | CCN1CCN(CC)[C@@H](c2ccc(O)cc2)[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C20H26N2O2/c1-3-21-13-14-22(4-2)20(16-7-11-18(24)12-8-16)19(21)15-5-9-17(23)10-6-15/h5-12,19-20,23-24H,3-4,13-14H2,1-2H3/t19-,20+ |
| InChIKey | OIBQWAYHWVPSPQ-BGYRXZFFSA-N |
| XLogP | 3.54 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2R,3S)-1,4-diethyl-3-(4-hydroxyphenyl)piperazin-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R,3S)-1,4-diethyl-3-(4-hydroxyphenyl)piperazin-2-yl]phenol?
The IUPAC name of 4-[(2R,3S)-1,4-diethyl-3-(4-hydroxyphenyl)piperazin-2-yl]phenol (CID 10925438) is 4-[(2R,3S)-1,4-diethyl-3-(4-hydroxyphenyl)piperazin-2-yl]phenol.
What is the SMILES notation for 4-[(2R,3S)-1,4-diethyl-3-(4-hydroxyphenyl)piperazin-2-yl]phenol?
The canonical SMILES for 4-[(2R,3S)-1,4-diethyl-3-(4-hydroxyphenyl)piperazin-2-yl]phenol is CCN1CCN(CC)[C@@H](c2ccc(O)cc2)[C@H]1c1ccc(O)cc1.
What is the InChIKey of 4-[(2R,3S)-1,4-diethyl-3-(4-hydroxyphenyl)piperazin-2-yl]phenol?
The InChIKey is OIBQWAYHWVPSPQ-BGYRXZFFSA-N. The full InChI is InChI=1S/C20H26N2O2/c1-3-21-13-14-22(4-2)20(16-7-11-18(24)12-8-16)19(21)15-5-9-17(23)10-6-15/h5-12,19-20,23-24H,3-4,13-14H2,1-2H3/t19-,20+.
What are the key properties of 4-[(2R,3S)-1,4-diethyl-3-(4-hydroxyphenyl)piperazin-2-yl]phenol?
4-[(2R,3S)-1,4-diethyl-3-(4-hydroxyphenyl)piperazin-2-yl]phenol has a molecular weight of 326.44 g/mol, XLogP of 3.54, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R,3S)-1,4-diethyl-3-(4-hydroxyphenyl)piperazin-2-yl]phenol is sourced from PubChem (CID 10925438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).