C17H18ClN5O3 — CID 109254548
N-(5-chloro-2-methoxyphenyl)-2-(4-formylpiperazin-1-yl)pyrimidine-5-carboxamide (PubChem CID 109254548) has the molecular formula C17H18ClN5O3 and a molecular weight of 375.82 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-(4-formylpiperazin-1-yl)pyrimidine-5-carboxamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-(4-formylpiperazin-1-yl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109254548 |
| Molecular Formula | C17H18ClN5O3 |
| Molecular Weight | 375.82 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-(4-formylpiperazin-1-yl)pyrimidine-5-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)c1cnc(N2CCN(C=O)CC2)nc1 |
| InChI | InChI=1S/C17H18ClN5O3/c1-26-15-3-2-13(18)8-14(15)21-16(25)12-9-19-17(20-10-12)23-6-4-22(11-24)5-7-23/h2-3,8-11H,4-7H2,1H3,(H,21,25) |
| InChIKey | QSAMWNMAHNJZMZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.82 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|