C18H14Cl2N4O — CID 109255356
N-benzyl-2-(2,5-dichloroanilino)pyrimidine-5-carboxamide (PubChem CID 109255356) has the molecular formula C18H14Cl2N4O and a molecular weight of 373.24 g/mol. Its IUPAC name is N-benzyl-2-(2,5-dichloroanilino)pyrimidine-5-carboxamide.
| Compound Name | N-benzyl-2-(2,5-dichloroanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109255356 |
| Molecular Formula | C18H14Cl2N4O |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | N-benzyl-2-(2,5-dichloroanilino)pyrimidine-5-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1cnc(Nc2cc(Cl)ccc2Cl)nc1 |
| InChI | InChI=1S/C18H14Cl2N4O/c19-14-6-7-15(20)16(8-14)24-18-22-10-13(11-23-18)17(25)21-9-12-4-2-1-3-5-12/h1-8,10-11H,9H2,(H,21,25)(H,22,23,24) |
| InChIKey | QKUFUZWVNBKQOX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |