C20H18N4O3 — CID 109255488
methyl 4-[[2-(benzylamino)pyrimidine-5-carbonyl]amino]benzoate (PubChem CID 109255488) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is methyl 4-[[2-(benzylamino)pyrimidine-5-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(benzylamino)pyrimidine-5-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109255488 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | methyl 4-[[2-(benzylamino)pyrimidine-5-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cnc(NCc3ccccc3)nc2)cc1 |
| InChI | InChI=1S/C20H18N4O3/c1-27-19(26)15-7-9-17(10-8-15)24-18(25)16-12-22-20(23-13-16)21-11-14-5-3-2-4-6-14/h2-10,12-13H,11H2,1H3,(H,24,25)(H,21,22,23) |
| InChIKey | KULPDMJXCOFNHX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |