About 6-hexoxy-3,4-diphenylpyridazine
6-hexoxy-3,4-diphenylpyridazine (PubChem CID 10925614) has the molecular formula C22H24N2O
and a molecular weight of 332.45 g/mol. Its IUPAC name is 6-hexoxy-3,4-diphenylpyridazine.
Molecular Properties
| Compound Name | 6-hexoxy-3,4-diphenylpyridazine |
| PubChem CID | 10925614 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 6-hexoxy-3,4-diphenylpyridazine |
| SMILES | CCCCCCOc1cc(-c2ccccc2)c(-c2ccccc2)nn1 |
| InChI | InChI=1S/C22H24N2O/c1-2-3-4-11-16-25-21-17-20(18-12-7-5-8-13-18)22(24-23-21)19-14-9-6-10-15-19/h5-10,12-15,17H,2-4,11,16H2,1H3 |
| InChIKey | GSVXNWWOLKQSNC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-hexoxy-3,4-diphenylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hexoxy-3,4-diphenylpyridazine?
The IUPAC name of 6-hexoxy-3,4-diphenylpyridazine (CID 10925614) is 6-hexoxy-3,4-diphenylpyridazine.
What is the SMILES notation for 6-hexoxy-3,4-diphenylpyridazine?
The canonical SMILES for 6-hexoxy-3,4-diphenylpyridazine is CCCCCCOc1cc(-c2ccccc2)c(-c2ccccc2)nn1.
What is the InChIKey of 6-hexoxy-3,4-diphenylpyridazine?
The InChIKey is GSVXNWWOLKQSNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O/c1-2-3-4-11-16-25-21-17-20(18-12-7-5-8-13-18)22(24-23-21)19-14-9-6-10-15-19/h5-10,12-15,17H,2-4,11,16H2,1H3.
What are the key properties of 6-hexoxy-3,4-diphenylpyridazine?
6-hexoxy-3,4-diphenylpyridazine has a molecular weight of 332.45 g/mol, XLogP of 5.77, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hexoxy-3,4-diphenylpyridazine is sourced from PubChem (CID 10925614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).