C20H18N2O3 — CID 10925670
2-(5,5-dimethyl-6,19-dioxa-10,11-diazapentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(20),2(7),3,8,11,13,15,17-octaen-10-yl)ethanol (PubChem CID 10925670) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-(5,5-dimethyl-6,19-dioxa-10,11-diazapentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(20),2(7),3,8,11,13,15,17-octaen-10-yl)ethanol.
| Compound Name | 2-(5,5-dimethyl-6,19-dioxa-10,11-diazapentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(20),2(7),3,8,11,13,15,17-octaen-10-yl)ethanol |
|---|---|
| PubChem CID | 10925670 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-(5,5-dimethyl-6,19-dioxa-10,11-diazapentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(20),2(7),3,8,11,13,15,17-octaen-10-yl)ethanol |
| SMILES | CC1(C)C=Cc2c(cc3c4c(nn3CCO)-c3ccccc3Oc24)O1 |
| InChI | InChI=1S/C20H18N2O3/c1-20(2)8-7-13-16(25-20)11-14-17-18(21-22(14)9-10-23)12-5-3-4-6-15(12)24-19(13)17/h3-8,11,23H,9-10H2,1-2H3 |
| InChIKey | TYRLCKRUTPZZQI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |