C18H15FN4O — CID 109256919
2-anilino-N-[(2-fluorophenyl)methyl]pyrimidine-5-carboxamide (PubChem CID 109256919) has the molecular formula C18H15FN4O and a molecular weight of 322.34 g/mol. Its IUPAC name is 2-anilino-N-[(2-fluorophenyl)methyl]pyrimidine-5-carboxamide.
| Compound Name | 2-anilino-N-[(2-fluorophenyl)methyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109256919 |
| Molecular Formula | C18H15FN4O |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2-anilino-N-[(2-fluorophenyl)methyl]pyrimidine-5-carboxamide |
| SMILES | O=C(NCc1ccccc1F)c1cnc(Nc2ccccc2)nc1 |
| InChI | InChI=1S/C18H15FN4O/c19-16-9-5-4-6-13(16)10-20-17(24)14-11-21-18(22-12-14)23-15-7-2-1-3-8-15/h1-9,11-12H,10H2,(H,20,24)(H,21,22,23) |
| InChIKey | RMHOHPISAMSVSO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |