C19H32O3Si — CID 10925747
(3R,3aR,7aR)-7a-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-6-methylspiro[1,2,3,3a-tetrahydroindene-5,1'-cyclopropane]-4-one (PubChem CID 10925747) has the molecular formula C19H32O3Si and a molecular weight of 336.55 g/mol. Its IUPAC name is (3R,3aR,7aR)-7a-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-6-methylspiro[1,2,3,3a-tetrahydroindene-5,1'-cyclopropane]-4-one.
| Compound Name | (3R,3aR,7aR)-7a-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-6-methylspiro[1,2,3,3a-tetrahydroindene-5,1'-cyclopropane]-4-one |
|---|---|
| PubChem CID | 10925747 |
| Molecular Formula | C19H32O3Si |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (3R,3aR,7aR)-7a-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-6-methylspiro[1,2,3,3a-tetrahydroindene-5,1'-cyclopropane]-4-one |
| SMILES | CC1=C[C@]2(CO[Si](C)(C)C(C)(C)C)CC[C@@H](O)[C@@H]2C(=O)C12CC2 |
| InChI | InChI=1S/C19H32O3Si/c1-13-11-18(12-22-23(5,6)17(2,3)4)8-7-14(20)15(18)16(21)19(13)9-10-19/h11,14-15,20H,7-10,12H2,1-6H3/t14-,15-,18+/m1/s1 |
| InChIKey | ZSNPKTVQSMWIDY-RKVPGOIHSA-N |
| XLogP | 4.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|