C21H42OSi — CID 10925811
tert-butyl-dimethyl-[(7Z,9E)-pentadeca-7,9-dien-6-yl]oxysilane (PubChem CID 10925811) has the molecular formula C21H42OSi and a molecular weight of 338.65 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(7Z,9E)-pentadeca-7,9-dien-6-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(7Z,9E)-pentadeca-7,9-dien-6-yl]oxysilane |
|---|---|
| PubChem CID | 10925811 |
| Molecular Formula | C21H42OSi |
| Molecular Weight | 338.65 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | tert-butyl-dimethyl-[(7Z,9E)-pentadeca-7,9-dien-6-yl]oxysilane |
| SMILES | CCCCC/C=C/C=C\C(CCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42OSi/c1-8-10-12-13-14-15-17-19-20(18-16-11-9-2)22-23(6,7)21(3,4)5/h14-15,17,19-20H,8-13,16,18H2,1-7H3/b15-14+,19-17- |
| InChIKey | NYYTUZKABUXADJ-GMXJTBKTSA-N |
| XLogP | 7.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.65 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|