C22H24N4O3 — CID 109258498
2-[benzyl(ethyl)amino]-N-(2,4-dimethoxyphenyl)pyrimidine-5-carboxamide (PubChem CID 109258498) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-[benzyl(ethyl)amino]-N-(2,4-dimethoxyphenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-[benzyl(ethyl)amino]-N-(2,4-dimethoxyphenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109258498 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-[benzyl(ethyl)amino]-N-(2,4-dimethoxyphenyl)pyrimidine-5-carboxamide |
| SMILES | CCN(Cc1ccccc1)c1ncc(C(=O)Nc2ccc(OC)cc2OC)cn1 |
| InChI | InChI=1S/C22H24N4O3/c1-4-26(15-16-8-6-5-7-9-16)22-23-13-17(14-24-22)21(27)25-19-11-10-18(28-2)12-20(19)29-3/h5-14H,4,15H2,1-3H3,(H,25,27) |
| InChIKey | XXUGOWUDKBWCBM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |