About (3-hydroxyphenyl) diphenyl phosphate
(3-hydroxyphenyl) diphenyl phosphate (PubChem CID 10925911) has the molecular formula C18H15O5P
and a molecular weight of 342.29 g/mol. Its IUPAC name is (3-hydroxyphenyl) diphenyl phosphate.
Molecular Properties
| Compound Name | (3-hydroxyphenyl) diphenyl phosphate |
| PubChem CID | 10925911 |
| Molecular Formula | C18H15O5P |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | (3-hydroxyphenyl) diphenyl phosphate |
| SMILES | O=P(Oc1ccccc1)(Oc1ccccc1)Oc1cccc(O)c1 |
| InChI | InChI=1S/C18H15O5P/c19-15-8-7-13-18(14-15)23-24(20,21-16-9-3-1-4-10-16)22-17-11-5-2-6-12-17/h1-14,19H |
| InChIKey | AWYVETCHVQGXMB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxyphenyl) diphenyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxyphenyl) diphenyl phosphate?
The IUPAC name of (3-hydroxyphenyl) diphenyl phosphate (CID 10925911) is (3-hydroxyphenyl) diphenyl phosphate.
What is the SMILES notation for (3-hydroxyphenyl) diphenyl phosphate?
The canonical SMILES for (3-hydroxyphenyl) diphenyl phosphate is O=P(Oc1ccccc1)(Oc1ccccc1)Oc1cccc(O)c1.
What is the InChIKey of (3-hydroxyphenyl) diphenyl phosphate?
The InChIKey is AWYVETCHVQGXMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15O5P/c19-15-8-7-13-18(14-15)23-24(20,21-16-9-3-1-4-10-16)22-17-11-5-2-6-12-17/h1-14,19H.
What are the key properties of (3-hydroxyphenyl) diphenyl phosphate?
(3-hydroxyphenyl) diphenyl phosphate has a molecular weight of 342.29 g/mol, XLogP of 5.04, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxyphenyl) diphenyl phosphate is sourced from PubChem (CID 10925911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).