C18H24N4O — CID 109259527
N-(3-methylbutyl)-2-(2-phenylethylamino)pyrimidine-5-carboxamide (PubChem CID 109259527) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is N-(3-methylbutyl)-2-(2-phenylethylamino)pyrimidine-5-carboxamide.
| Compound Name | N-(3-methylbutyl)-2-(2-phenylethylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109259527 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N-(3-methylbutyl)-2-(2-phenylethylamino)pyrimidine-5-carboxamide |
| SMILES | CC(C)CCNC(=O)c1cnc(NCCc2ccccc2)nc1 |
| InChI | InChI=1S/C18H24N4O/c1-14(2)8-10-19-17(23)16-12-21-18(22-13-16)20-11-9-15-6-4-3-5-7-15/h3-7,12-14H,8-11H2,1-2H3,(H,19,23)(H,20,21,22) |
| InChIKey | LKOFHJVVNCPDAO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |