About [(5S,7R)-3-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-1-adamantyl] acetate
[(5S,7R)-3-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-1-adamantyl] acetate (PubChem CID 10926029) has the molecular formula C19H27N3O3
and a molecular weight of 345.44 g/mol. Its IUPAC name is [(5S,7R)-3-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-1-adamantyl] acetate.
Molecular Properties
| Compound Name | [(5S,7R)-3-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-1-adamantyl] acetate |
| PubChem CID | 10926029 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | [(5S,7R)-3-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-1-adamantyl] acetate |
| SMILES | CC(=O)OC12C[C@@H]3C[C@@H](CC(NCC(=O)N4CCC[C@H]4C#N)(C3)C1)C2 |
| InChI | InChI=1S/C19H27N3O3/c1-13(23)25-19-8-14-5-15(9-19)7-18(6-14,12-19)21-11-17(24)22-4-2-3-16(22)10-20/h14-16,21H,2-9,11-12H2,1H3/t14-,15+,16-,18?,19?/m0/s1 |
| InChIKey | WBNMIQDSUPJJAH-KIBZJKDMSA-N |
| XLogP | 1.75 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(5S,7R)-3-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-1-adamantyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S,7R)-3-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-1-adamantyl] acetate?
The IUPAC name of [(5S,7R)-3-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-1-adamantyl] acetate (CID 10926029) is [(5S,7R)-3-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-1-adamantyl] acetate.
What is the SMILES notation for [(5S,7R)-3-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-1-adamantyl] acetate?
The canonical SMILES for [(5S,7R)-3-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-1-adamantyl] acetate is CC(=O)OC12C[C@@H]3C[C@@H](CC(NCC(=O)N4CCC[C@H]4C#N)(C3)C1)C2.
What is the InChIKey of [(5S,7R)-3-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-1-adamantyl] acetate?
The InChIKey is WBNMIQDSUPJJAH-KIBZJKDMSA-N. The full InChI is InChI=1S/C19H27N3O3/c1-13(23)25-19-8-14-5-15(9-19)7-18(6-14,12-19)21-11-17(24)22-4-2-3-16(22)10-20/h14-16,21H,2-9,11-12H2,1H3/t14-,15+,16-,18?,19?/m0/s1.
What are the key properties of [(5S,7R)-3-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-1-adamantyl] acetate?
[(5S,7R)-3-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-1-adamantyl] acetate has a molecular weight of 345.44 g/mol, XLogP of 1.75, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S,7R)-3-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-1-adamantyl] acetate is sourced from PubChem (CID 10926029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).