C22H22FN5O — CID 109262099
[4-(2-fluorophenyl)piperazin-1-yl]-[2-(N-methylanilino)pyrimidin-5-yl]methanone (PubChem CID 109262099) has the molecular formula C22H22FN5O and a molecular weight of 391.45 g/mol. Its IUPAC name is [4-(2-fluorophenyl)piperazin-1-yl]-[2-(N-methylanilino)pyrimidin-5-yl]methanone.
| Compound Name | [4-(2-fluorophenyl)piperazin-1-yl]-[2-(N-methylanilino)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 109262099 |
| Molecular Formula | C22H22FN5O |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | [4-(2-fluorophenyl)piperazin-1-yl]-[2-(N-methylanilino)pyrimidin-5-yl]methanone |
| SMILES | CN(c1ccccc1)c1ncc(C(=O)N2CCN(c3ccccc3F)CC2)cn1 |
| InChI | InChI=1S/C22H22FN5O/c1-26(18-7-3-2-4-8-18)22-24-15-17(16-25-22)21(29)28-13-11-27(12-14-28)20-10-6-5-9-19(20)23/h2-10,15-16H,11-14H2,1H3 |
| InChIKey | WZBRPUIQTFVXEW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |