C17H23NO2Se — CID 10926213
ethyl (7R,8R,8aS)-8-phenylselanyl-1,2,3,5,6,7,8,8a-octahydroindolizine-7-carboxylate (PubChem CID 10926213) has the molecular formula C17H23NO2Se and a molecular weight of 352.34 g/mol. Its IUPAC name is ethyl (7R,8R,8aS)-8-phenylselanyl-1,2,3,5,6,7,8,8a-octahydroindolizine-7-carboxylate.
| Compound Name | ethyl (7R,8R,8aS)-8-phenylselanyl-1,2,3,5,6,7,8,8a-octahydroindolizine-7-carboxylate |
|---|---|
| PubChem CID | 10926213 |
| Molecular Formula | C17H23NO2Se |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | ethyl (7R,8R,8aS)-8-phenylselanyl-1,2,3,5,6,7,8,8a-octahydroindolizine-7-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCN2CCC[C@H]2[C@@H]1[Se]c1ccccc1 |
| InChI | InChI=1S/C17H23NO2Se/c1-2-20-17(19)14-10-12-18-11-6-9-15(18)16(14)21-13-7-4-3-5-8-13/h3-5,7-8,14-16H,2,6,9-12H2,1H3/t14-,15-,16+/m0/s1 |
| InChIKey | LAMJEVAAHSYUPM-HRCADAONSA-N |
| XLogP | 1.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|