C20H19NO5 — CID 10926252
benzyl (2S)-1-(5-oxo-2-prop-2-ynyloxolane-2-carbonyl)-2,3-dihydropyrrole-2-carboxylate (PubChem CID 10926252) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is benzyl (2S)-1-(5-oxo-2-prop-2-ynyloxolane-2-carbonyl)-2,3-dihydropyrrole-2-carboxylate.
| Compound Name | benzyl (2S)-1-(5-oxo-2-prop-2-ynyloxolane-2-carbonyl)-2,3-dihydropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 10926252 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | benzyl (2S)-1-(5-oxo-2-prop-2-ynyloxolane-2-carbonyl)-2,3-dihydropyrrole-2-carboxylate |
| SMILES | C#CCC1(C(=O)N2C=CC[C@H]2C(=O)OCc2ccccc2)CCC(=O)O1 |
| InChI | InChI=1S/C20H19NO5/c1-2-11-20(12-10-17(22)26-20)19(24)21-13-6-9-16(21)18(23)25-14-15-7-4-3-5-8-15/h1,3-8,13,16H,9-12,14H2/t16-,20?/m0/s1 |
| InChIKey | BVNRJOMKUZDRJK-DJZRFWRSSA-N |
| XLogP | 1.94 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|