C10H3Cl2F6NO2 — CID 10926270
1,4-dichloro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-isocyanatobenzene (PubChem CID 10926270) has the molecular formula C10H3Cl2F6NO2 and a molecular weight of 354.03 g/mol. Its IUPAC name is 1,4-dichloro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-isocyanatobenzene.
| Compound Name | 1,4-dichloro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-isocyanatobenzene |
|---|---|
| PubChem CID | 10926270 |
| Molecular Formula | C10H3Cl2F6NO2 |
| Molecular Weight | 354.03 g/mol |
| Exact Mass | 352.94 |
| IUPAC Name | 1,4-dichloro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-isocyanatobenzene |
| SMILES | O=C=Nc1cc(Cl)c(OC(F)(F)C(F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H3Cl2F6NO2/c11-4-2-7(5(12)1-6(4)19-3-20)21-10(17,18)8(13)9(14,15)16/h1-2,8H |
| InChIKey | BTVPEVSSXDVLFO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.03 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|