C22H24N4O3 — CID 109262764
2-(3,5-dimethylanilino)-N-[2-(4-methoxyphenoxy)ethyl]pyrimidine-5-carboxamide (PubChem CID 109262764) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-(3,5-dimethylanilino)-N-[2-(4-methoxyphenoxy)ethyl]pyrimidine-5-carboxamide.
| Compound Name | 2-(3,5-dimethylanilino)-N-[2-(4-methoxyphenoxy)ethyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109262764 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-(3,5-dimethylanilino)-N-[2-(4-methoxyphenoxy)ethyl]pyrimidine-5-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)c2cnc(Nc3cc(C)cc(C)c3)nc2)cc1 |
| InChI | InChI=1S/C22H24N4O3/c1-15-10-16(2)12-18(11-15)26-22-24-13-17(14-25-22)21(27)23-8-9-29-20-6-4-19(28-3)5-7-20/h4-7,10-14H,8-9H2,1-3H3,(H,23,27)(H,24,25,26) |
| InChIKey | OPXLXLMQXCKTPB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|