About CID 10926354
CID 10926354 (PubChem CID 10926354) has the molecular formula C13H19GeNO2S2
and a molecular weight of 358.04 g/mol.
Molecular Properties
| Compound Name | CID 10926354 |
| PubChem CID | 10926354 |
| Molecular Formula | C13H19GeNO2S2 |
| Molecular Weight | 358.04 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | — |
| SMILES | CN(CCO)CCO.c1csc([Ge]c2cccs2)c1 |
| InChI | InChI=1S/C8H6GeS2.C5H13NO2/c1-3-7(10-5-1)9-8-4-2-6-11-8;1-6(2-4-7)3-5-8/h1-6H;7-8H,2-5H2,1H3 |
| InChIKey | LDBBMICUFLYKCS-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.04 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 10926354 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10926354?
The IUPAC name of CID 10926354 (CID 10926354) is not available.
What is the SMILES notation for CID 10926354?
The canonical SMILES for CID 10926354 is CN(CCO)CCO.c1csc([Ge]c2cccs2)c1.
What is the InChIKey of CID 10926354?
The InChIKey is LDBBMICUFLYKCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6GeS2.C5H13NO2/c1-3-7(10-5-1)9-8-4-2-6-11-8;1-6(2-4-7)3-5-8/h1-6H;7-8H,2-5H2,1H3.
What are the key properties of CID 10926354?
CID 10926354 has a molecular weight of 358.04 g/mol, XLogP of 0.37, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10926354 is sourced from PubChem (CID 10926354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).