C17H21ClN4O2 — CID 109263675
2-(5-chloro-2-methoxyanilino)-N-pentylpyrimidine-5-carboxamide (PubChem CID 109263675) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyanilino)-N-pentylpyrimidine-5-carboxamide.
| Compound Name | 2-(5-chloro-2-methoxyanilino)-N-pentylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109263675 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-(5-chloro-2-methoxyanilino)-N-pentylpyrimidine-5-carboxamide |
| SMILES | CCCCCNC(=O)c1cnc(Nc2cc(Cl)ccc2OC)nc1 |
| InChI | InChI=1S/C17H21ClN4O2/c1-3-4-5-8-19-16(23)12-10-20-17(21-11-12)22-14-9-13(18)6-7-15(14)24-2/h6-7,9-11H,3-5,8H2,1-2H3,(H,19,23)(H,20,21,22) |
| InChIKey | MIJMDJHEDOANPG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|