C19H16N4O — CID 109265177
(2-anilinopyrimidin-5-yl)-(2,3-dihydroindol-1-yl)methanone (PubChem CID 109265177) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is (2-anilinopyrimidin-5-yl)-(2,3-dihydroindol-1-yl)methanone.
| Compound Name | (2-anilinopyrimidin-5-yl)-(2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 109265177 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (2-anilinopyrimidin-5-yl)-(2,3-dihydroindol-1-yl)methanone |
| SMILES | O=C(c1cnc(Nc2ccccc2)nc1)N1CCc2ccccc21 |
| InChI | InChI=1S/C19H16N4O/c24-18(23-11-10-14-6-4-5-9-17(14)23)15-12-20-19(21-13-15)22-16-7-2-1-3-8-16/h1-9,12-13H,10-11H2,(H,20,21,22) |
| InChIKey | VUCJPWACOZCIJR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |