C20H19ClN4O2 — CID 109265367
2-(4-chloro-2-methoxy-5-methylanilino)-N-(2-methylphenyl)pyrimidine-5-carboxamide (PubChem CID 109265367) has the molecular formula C20H19ClN4O2 and a molecular weight of 382.85 g/mol. Its IUPAC name is 2-(4-chloro-2-methoxy-5-methylanilino)-N-(2-methylphenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(4-chloro-2-methoxy-5-methylanilino)-N-(2-methylphenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109265367 |
| Molecular Formula | C20H19ClN4O2 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-(4-chloro-2-methoxy-5-methylanilino)-N-(2-methylphenyl)pyrimidine-5-carboxamide |
| SMILES | COc1cc(Cl)c(C)cc1Nc1ncc(C(=O)Nc2ccccc2C)cn1 |
| InChI | InChI=1S/C20H19ClN4O2/c1-12-6-4-5-7-16(12)24-19(26)14-10-22-20(23-11-14)25-17-8-13(2)15(21)9-18(17)27-3/h4-11H,1-3H3,(H,24,26)(H,22,23,25) |
| InChIKey | NWKCFMGDPHDRLJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |