About (3,5-dimethoxyphenyl)-(2-phenyl-1,3-dithian-2-yl)methanol
(3,5-dimethoxyphenyl)-(2-phenyl-1,3-dithian-2-yl)methanol (PubChem CID 10926553) has the molecular formula C19H22O3S2
and a molecular weight of 362.52 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-(2-phenyl-1,3-dithian-2-yl)methanol.
Molecular Properties
| Compound Name | (3,5-dimethoxyphenyl)-(2-phenyl-1,3-dithian-2-yl)methanol |
| PubChem CID | 10926553 |
| Molecular Formula | C19H22O3S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | (3,5-dimethoxyphenyl)-(2-phenyl-1,3-dithian-2-yl)methanol |
| SMILES | COc1cc(OC)cc(C(O)C2(c3ccccc3)SCCCS2)c1 |
| InChI | InChI=1S/C19H22O3S2/c1-21-16-11-14(12-17(13-16)22-2)18(20)19(23-9-6-10-24-19)15-7-4-3-5-8-15/h3-5,7-8,11-13,18,20H,6,9-10H2,1-2H3 |
| InChIKey | STOAMCILZWAXBB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3,5-dimethoxyphenyl)-(2-phenyl-1,3-dithian-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethoxyphenyl)-(2-phenyl-1,3-dithian-2-yl)methanol?
The IUPAC name of (3,5-dimethoxyphenyl)-(2-phenyl-1,3-dithian-2-yl)methanol (CID 10926553) is (3,5-dimethoxyphenyl)-(2-phenyl-1,3-dithian-2-yl)methanol.
What is the SMILES notation for (3,5-dimethoxyphenyl)-(2-phenyl-1,3-dithian-2-yl)methanol?
The canonical SMILES for (3,5-dimethoxyphenyl)-(2-phenyl-1,3-dithian-2-yl)methanol is COc1cc(OC)cc(C(O)C2(c3ccccc3)SCCCS2)c1.
What is the InChIKey of (3,5-dimethoxyphenyl)-(2-phenyl-1,3-dithian-2-yl)methanol?
The InChIKey is STOAMCILZWAXBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O3S2/c1-21-16-11-14(12-17(13-16)22-2)18(20)19(23-9-6-10-24-19)15-7-4-3-5-8-15/h3-5,7-8,11-13,18,20H,6,9-10H2,1-2H3.
What are the key properties of (3,5-dimethoxyphenyl)-(2-phenyl-1,3-dithian-2-yl)methanol?
(3,5-dimethoxyphenyl)-(2-phenyl-1,3-dithian-2-yl)methanol has a molecular weight of 362.52 g/mol, XLogP of 4.46, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethoxyphenyl)-(2-phenyl-1,3-dithian-2-yl)methanol is sourced from PubChem (CID 10926553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).