C22H40O2Si — CID 10926599
(1S,2S,4S,8R)-8-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-2-ethenyl-1-methylbicyclo[2.2.2]oct-5-en-2-ol (PubChem CID 10926599) has the molecular formula C22H40O2Si and a molecular weight of 364.65 g/mol. Its IUPAC name is (1S,2S,4S,8R)-8-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-2-ethenyl-1-methylbicyclo[2.2.2]oct-5-en-2-ol.
| Compound Name | (1S,2S,4S,8R)-8-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-2-ethenyl-1-methylbicyclo[2.2.2]oct-5-en-2-ol |
|---|---|
| PubChem CID | 10926599 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | (1S,2S,4S,8R)-8-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-2-ethenyl-1-methylbicyclo[2.2.2]oct-5-en-2-ol |
| SMILES | C=C[C@@]1(O)C[C@H]2C=C[C@]1(C)C[C@H]2[C@H](CO[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C22H40O2Si/c1-10-22(23)13-17-11-12-21(22,7)14-18(17)19(16(2)3)15-24-25(8,9)20(4,5)6/h10-12,16-19,23H,1,13-15H2,2-9H3/t17-,18-,19-,21-,22-/m1/s1 |
| InChIKey | YRRLPOLCEWTWSC-VTRMHMOVSA-N |
| XLogP | 5.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|