C22H42O2Si — CID 10926662
(1R,2S,4aS,8aS)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,5,5,8a-tetramethyl-4a,6,7,8-tetrahydro-1H-naphthalen-2-ol (PubChem CID 10926662) has the molecular formula C22H42O2Si and a molecular weight of 366.66 g/mol. Its IUPAC name is (1R,2S,4aS,8aS)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,5,5,8a-tetramethyl-4a,6,7,8-tetrahydro-1H-naphthalen-2-ol.
| Compound Name | (1R,2S,4aS,8aS)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,5,5,8a-tetramethyl-4a,6,7,8-tetrahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 10926662 |
| Molecular Formula | C22H42O2Si |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | (1R,2S,4aS,8aS)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,5,5,8a-tetramethyl-4a,6,7,8-tetrahydro-1H-naphthalen-2-ol |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H](CCO[Si](C)(C)C(C)(C)C)[C@@](C)(O)C=C[C@@H]12 |
| InChI | InChI=1S/C22H42O2Si/c1-19(2,3)25(8,9)24-16-12-18-21(6)14-10-13-20(4,5)17(21)11-15-22(18,7)23/h11,15,17-18,23H,10,12-14,16H2,1-9H3/t17-,18+,21-,22-/m0/s1 |
| InChIKey | LXQZWUNYKJZDJB-UDKICSLYSA-N |
| XLogP | 6.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|